C17H12O3S — CID 15277895
16-methyltetracyclo[11.2.1.06,15.08,14]hexadeca-1(16),2,4,6,8,10,12,14-octaene-7-sulfonic acid (PubChem CID 15277895) has the molecular formula C17H12O3S and a molecular weight of 296.35 g/mol. Its IUPAC name is 16-methyltetracyclo[11.2.1.06,15.08,14]hexadeca-1(16),2,4,6,8,10,12,14-octaene-7-sulfonic acid.
| Compound Name | 16-methyltetracyclo[11.2.1.06,15.08,14]hexadeca-1(16),2,4,6,8,10,12,14-octaene-7-sulfonic acid |
|---|---|
| PubChem CID | 15277895 |
| Molecular Formula | C17H12O3S |
| Molecular Weight | 296.35 g/mol |
| Exact Mass | 296.05 |
| IUPAC Name | 16-methyltetracyclo[11.2.1.06,15.08,14]hexadeca-1(16),2,4,6,8,10,12,14-octaene-7-sulfonic acid |
| SMILES | Cc1c2ccccc3c(S(=O)(=O)O)c4ccccc1c4c23 |
| InChI | InChI=1S/C17H12O3S/c1-10-11-6-2-4-8-13-15(11)16-12(10)7-3-5-9-14(16)17(13)21(18,19)20/h2-9H,1H3,(H,18,19,20) |
| InChIKey | ASIDEGIDLOHIQH-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.35 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azulene(4)', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|