About 4-methyl-2-nitrocyclohexa-1,5-diene-1,4-diamine
4-methyl-2-nitrocyclohexa-1,5-diene-1,4-diamine (PubChem CID 152780063) has the molecular formula C7H11N3O2
and a molecular weight of 169.18 g/mol. Its IUPAC name is 4-methyl-2-nitrocyclohexa-1,5-diene-1,4-diamine.
Molecular Properties
| Compound Name | 4-methyl-2-nitrocyclohexa-1,5-diene-1,4-diamine |
| PubChem CID | 152780063 |
| Molecular Formula | C7H11N3O2 |
| Molecular Weight | 169.18 g/mol |
| Exact Mass | 169.09 |
| IUPAC Name | 4-methyl-2-nitrocyclohexa-1,5-diene-1,4-diamine |
| SMILES | CC1(N)C=CC(N)=C([N+](=O)[O-])C1 |
| InChI | InChI=1S/C7H11N3O2/c1-7(9)3-2-5(8)6(4-7)10(11)12/h2-3H,4,8-9H2,1H3 |
| InChIKey | SIUUNGZTUDGJBI-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 95.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.18 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-methyl-2-nitrocyclohexa-1,5-diene-1,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-2-nitrocyclohexa-1,5-diene-1,4-diamine?
The IUPAC name of 4-methyl-2-nitrocyclohexa-1,5-diene-1,4-diamine (CID 152780063) is 4-methyl-2-nitrocyclohexa-1,5-diene-1,4-diamine.
What is the SMILES notation for 4-methyl-2-nitrocyclohexa-1,5-diene-1,4-diamine?
The canonical SMILES for 4-methyl-2-nitrocyclohexa-1,5-diene-1,4-diamine is CC1(N)C=CC(N)=C([N+](=O)[O-])C1.
What is the InChIKey of 4-methyl-2-nitrocyclohexa-1,5-diene-1,4-diamine?
The InChIKey is SIUUNGZTUDGJBI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11N3O2/c1-7(9)3-2-5(8)6(4-7)10(11)12/h2-3H,4,8-9H2,1H3.
What are the key properties of 4-methyl-2-nitrocyclohexa-1,5-diene-1,4-diamine?
4-methyl-2-nitrocyclohexa-1,5-diene-1,4-diamine has a molecular weight of 169.18 g/mol, XLogP of 0.11, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-2-nitrocyclohexa-1,5-diene-1,4-diamine is sourced from PubChem (CID 152780063), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).