About [2-(aminomethyl)-4,5-dimethylcyclohexa-1,4-dien-1-yl]methanamine
[2-(aminomethyl)-4,5-dimethylcyclohexa-1,4-dien-1-yl]methanamine (PubChem CID 15278039) has the molecular formula C10H18N2
and a molecular weight of 166.27 g/mol. Its IUPAC name is [2-(aminomethyl)-4,5-dimethylcyclohexa-1,4-dien-1-yl]methanamine.
Molecular Properties
| Compound Name | [2-(aminomethyl)-4,5-dimethylcyclohexa-1,4-dien-1-yl]methanamine |
| PubChem CID | 15278039 |
| Molecular Formula | C10H18N2 |
| Molecular Weight | 166.27 g/mol |
| Exact Mass | 166.15 |
| IUPAC Name | [2-(aminomethyl)-4,5-dimethylcyclohexa-1,4-dien-1-yl]methanamine |
| SMILES | CC1=C(C)CC(CN)=C(CN)C1 |
| InChI | InChI=1S/C10H18N2/c1-7-3-9(5-11)10(6-12)4-8(7)2/h3-6,11-12H2,1-2H3 |
| InChIKey | MHDHXFQNEZAYRF-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.27 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [2-(aminomethyl)-4,5-dimethylcyclohexa-1,4-dien-1-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(aminomethyl)-4,5-dimethylcyclohexa-1,4-dien-1-yl]methanamine?
The IUPAC name of [2-(aminomethyl)-4,5-dimethylcyclohexa-1,4-dien-1-yl]methanamine (CID 15278039) is [2-(aminomethyl)-4,5-dimethylcyclohexa-1,4-dien-1-yl]methanamine.
What is the SMILES notation for [2-(aminomethyl)-4,5-dimethylcyclohexa-1,4-dien-1-yl]methanamine?
The canonical SMILES for [2-(aminomethyl)-4,5-dimethylcyclohexa-1,4-dien-1-yl]methanamine is CC1=C(C)CC(CN)=C(CN)C1.
What is the InChIKey of [2-(aminomethyl)-4,5-dimethylcyclohexa-1,4-dien-1-yl]methanamine?
The InChIKey is MHDHXFQNEZAYRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N2/c1-7-3-9(5-11)10(6-12)4-8(7)2/h3-6,11-12H2,1-2H3.
What are the key properties of [2-(aminomethyl)-4,5-dimethylcyclohexa-1,4-dien-1-yl]methanamine?
[2-(aminomethyl)-4,5-dimethylcyclohexa-1,4-dien-1-yl]methanamine has a molecular weight of 166.27 g/mol, XLogP of 1.33, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(aminomethyl)-4,5-dimethylcyclohexa-1,4-dien-1-yl]methanamine is sourced from PubChem (CID 15278039), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).