C14H25N5 — CID 152780503
4-(5,5-dimethyl-2,3,6,7,8,8a-hexahydro-1H-indolizin-7-yl)-1H-pyrimidine-2,4-diamine (PubChem CID 152780503) has the molecular formula C14H25N5 and a molecular weight of 263.39 g/mol. Its IUPAC name is 4-(5,5-dimethyl-2,3,6,7,8,8a-hexahydro-1H-indolizin-7-yl)-1H-pyrimidine-2,4-diamine.
| Compound Name | 4-(5,5-dimethyl-2,3,6,7,8,8a-hexahydro-1H-indolizin-7-yl)-1H-pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 152780503 |
| Molecular Formula | C14H25N5 |
| Molecular Weight | 263.39 g/mol |
| Exact Mass | 263.21 |
| IUPAC Name | 4-(5,5-dimethyl-2,3,6,7,8,8a-hexahydro-1H-indolizin-7-yl)-1H-pyrimidine-2,4-diamine |
| SMILES | CC1(C)CC(C2(N)C=CNC(N)=N2)CC2CCCN21 |
| InChI | InChI=1S/C14H25N5/c1-13(2)9-10(8-11-4-3-7-19(11)13)14(16)5-6-17-12(15)18-14/h5-6,10-11H,3-4,7-9,16H2,1-2H3,(H3,15,17,18) |
| InChIKey | XMMQZBAIAYQGFP-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 79.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.39 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |