C12H21N5 — CID 152780504
4-(1,2,3,5,6,7,8,8a-octahydroindolizin-7-yl)-1H-pyrimidine-2,4-diamine (PubChem CID 152780504) has the molecular formula C12H21N5 and a molecular weight of 235.33 g/mol. Its IUPAC name is 4-(1,2,3,5,6,7,8,8a-octahydroindolizin-7-yl)-1H-pyrimidine-2,4-diamine.
| Compound Name | 4-(1,2,3,5,6,7,8,8a-octahydroindolizin-7-yl)-1H-pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 152780504 |
| Molecular Formula | C12H21N5 |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.18 |
| IUPAC Name | 4-(1,2,3,5,6,7,8,8a-octahydroindolizin-7-yl)-1H-pyrimidine-2,4-diamine |
| SMILES | NC1=NC(N)(C2CCN3CCCC3C2)C=CN1 |
| InChI | InChI=1S/C12H21N5/c13-11-15-5-4-12(14,16-11)9-3-7-17-6-1-2-10(17)8-9/h4-5,9-10H,1-3,6-8,14H2,(H3,13,15,16) |
| InChIKey | FCECZAULLRIOJJ-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 79.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |