About (4-azido-2,6-dimethylhept-1-en-4-yl)-tert-butyldiazene
(4-azido-2,6-dimethylhept-1-en-4-yl)-tert-butyldiazene (PubChem CID 152781152) has the molecular formula C13H25N5
and a molecular weight of 251.38 g/mol. Its IUPAC name is (4-azido-2,6-dimethylhept-1-en-4-yl)-tert-butyldiazene.
Molecular Properties
| Compound Name | (4-azido-2,6-dimethylhept-1-en-4-yl)-tert-butyldiazene |
| PubChem CID | 152781152 |
| Molecular Formula | C13H25N5 |
| Molecular Weight | 251.38 g/mol |
| Exact Mass | 251.21 |
| IUPAC Name | (4-azido-2,6-dimethylhept-1-en-4-yl)-tert-butyldiazene |
| SMILES | C=C(C)CC(CC(C)C)(N=[N+]=[N-])/N=N/C(C)(C)C |
| InChI | InChI=1S/C13H25N5/c1-10(2)8-13(17-18-14,9-11(3)4)16-15-12(5,6)7/h11H,1,8-9H2,2-7H3/b16-15+ |
| InChIKey | XWIXKLLLDJOSSF-FOCLMDBBSA-N |
| XLogP | 5.26 |
| TPSA | 73.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 251.38 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze (4-azido-2,6-dimethylhept-1-en-4-yl)-tert-butyldiazene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-azido-2,6-dimethylhept-1-en-4-yl)-tert-butyldiazene?
The IUPAC name of (4-azido-2,6-dimethylhept-1-en-4-yl)-tert-butyldiazene (CID 152781152) is (4-azido-2,6-dimethylhept-1-en-4-yl)-tert-butyldiazene.
What is the SMILES notation for (4-azido-2,6-dimethylhept-1-en-4-yl)-tert-butyldiazene?
The canonical SMILES for (4-azido-2,6-dimethylhept-1-en-4-yl)-tert-butyldiazene is C=C(C)CC(CC(C)C)(N=[N+]=[N-])/N=N/C(C)(C)C.
What is the InChIKey of (4-azido-2,6-dimethylhept-1-en-4-yl)-tert-butyldiazene?
The InChIKey is XWIXKLLLDJOSSF-FOCLMDBBSA-N. The full InChI is InChI=1S/C13H25N5/c1-10(2)8-13(17-18-14,9-11(3)4)16-15-12(5,6)7/h11H,1,8-9H2,2-7H3/b16-15+.
What are the key properties of (4-azido-2,6-dimethylhept-1-en-4-yl)-tert-butyldiazene?
(4-azido-2,6-dimethylhept-1-en-4-yl)-tert-butyldiazene has a molecular weight of 251.38 g/mol, XLogP of 5.26, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-azido-2,6-dimethylhept-1-en-4-yl)-tert-butyldiazene is sourced from PubChem (CID 152781152), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).