About 5-(2,4-dichlorophenyl)-2-(N-ethoxy-C-ethylcarbonimidoyl)-3-hydroxycyclohex-2-en-1-one
5-(2,4-dichlorophenyl)-2-(N-ethoxy-C-ethylcarbonimidoyl)-3-hydroxycyclohex-2-en-1-one (PubChem CID 152781628) has the molecular formula C17H19Cl2NO3
and a molecular weight of 356.25 g/mol. Its IUPAC name is 5-(2,4-dichlorophenyl)-2-(N-ethoxy-C-ethylcarbonimidoyl)-3-hydroxycyclohex-2-en-1-one.
Molecular Properties
| Compound Name | 5-(2,4-dichlorophenyl)-2-(N-ethoxy-C-ethylcarbonimidoyl)-3-hydroxycyclohex-2-en-1-one |
| PubChem CID | 152781628 |
| Molecular Formula | C17H19Cl2NO3 |
| Molecular Weight | 356.25 g/mol |
| Exact Mass | 355.07 |
| IUPAC Name | 5-(2,4-dichlorophenyl)-2-(N-ethoxy-C-ethylcarbonimidoyl)-3-hydroxycyclohex-2-en-1-one |
| SMILES | CCON=C(CC)C1=C(O)CC(c2ccc(Cl)cc2Cl)CC1=O |
| InChI | InChI=1S/C17H19Cl2NO3/c1-3-14(20-23-4-2)17-15(21)7-10(8-16(17)22)12-6-5-11(18)9-13(12)19/h5-6,9-10,21H,3-4,7-8H2,1-2H3 |
| InChIKey | LJVJXHRWCJDACQ-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 356.25 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-(2,4-dichlorophenyl)-2-(N-ethoxy-C-ethylcarbonimidoyl)-3-hydroxycyclohex-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2,4-dichlorophenyl)-2-(N-ethoxy-C-ethylcarbonimidoyl)-3-hydroxycyclohex-2-en-1-one?
The IUPAC name of 5-(2,4-dichlorophenyl)-2-(N-ethoxy-C-ethylcarbonimidoyl)-3-hydroxycyclohex-2-en-1-one (CID 152781628) is 5-(2,4-dichlorophenyl)-2-(N-ethoxy-C-ethylcarbonimidoyl)-3-hydroxycyclohex-2-en-1-one.
What is the SMILES notation for 5-(2,4-dichlorophenyl)-2-(N-ethoxy-C-ethylcarbonimidoyl)-3-hydroxycyclohex-2-en-1-one?
The canonical SMILES for 5-(2,4-dichlorophenyl)-2-(N-ethoxy-C-ethylcarbonimidoyl)-3-hydroxycyclohex-2-en-1-one is CCON=C(CC)C1=C(O)CC(c2ccc(Cl)cc2Cl)CC1=O.
What is the InChIKey of 5-(2,4-dichlorophenyl)-2-(N-ethoxy-C-ethylcarbonimidoyl)-3-hydroxycyclohex-2-en-1-one?
The InChIKey is LJVJXHRWCJDACQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19Cl2NO3/c1-3-14(20-23-4-2)17-15(21)7-10(8-16(17)22)12-6-5-11(18)9-13(12)19/h5-6,9-10,21H,3-4,7-8H2,1-2H3.
What are the key properties of 5-(2,4-dichlorophenyl)-2-(N-ethoxy-C-ethylcarbonimidoyl)-3-hydroxycyclohex-2-en-1-one?
5-(2,4-dichlorophenyl)-2-(N-ethoxy-C-ethylcarbonimidoyl)-3-hydroxycyclohex-2-en-1-one has a molecular weight of 356.25 g/mol, XLogP of 5.05, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2,4-dichlorophenyl)-2-(N-ethoxy-C-ethylcarbonimidoyl)-3-hydroxycyclohex-2-en-1-one is sourced from PubChem (CID 152781628), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).