C18H25N3O2 — CID 152781855
5-[3-[3-(piperidin-1-ylmethyl)phenoxy]propyl]-1,2-dihydropyrazol-3-one (PubChem CID 152781855) has the molecular formula C18H25N3O2 and a molecular weight of 315.42 g/mol. Its IUPAC name is 5-[3-[3-(piperidin-1-ylmethyl)phenoxy]propyl]-1,2-dihydropyrazol-3-one.
| Compound Name | 5-[3-[3-(piperidin-1-ylmethyl)phenoxy]propyl]-1,2-dihydropyrazol-3-one |
|---|---|
| PubChem CID | 152781855 |
| Molecular Formula | C18H25N3O2 |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.19 |
| IUPAC Name | 5-[3-[3-(piperidin-1-ylmethyl)phenoxy]propyl]-1,2-dihydropyrazol-3-one |
| SMILES | O=c1cc(CCCOc2cccc(CN3CCCCC3)c2)[nH][nH]1 |
| InChI | InChI=1S/C18H25N3O2/c22-18-13-16(19-20-18)7-5-11-23-17-8-4-6-15(12-17)14-21-9-2-1-3-10-21/h4,6,8,12-13H,1-3,5,7,9-11,14H2,(H2,19,20,22) |
| InChIKey | KXJGCQRZURSTPZ-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 61.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|