About 1-methyl-2H-pyridine-2,4-diamine
1-methyl-2H-pyridine-2,4-diamine (PubChem CID 152784170) has the molecular formula C6H11N3
and a molecular weight of 125.17 g/mol. Its IUPAC name is 1-methyl-2H-pyridine-2,4-diamine.
Molecular Properties
| Compound Name | 1-methyl-2H-pyridine-2,4-diamine |
| PubChem CID | 152784170 |
| Molecular Formula | C6H11N3 |
| Molecular Weight | 125.17 g/mol |
| Exact Mass | 125.10 |
| IUPAC Name | 1-methyl-2H-pyridine-2,4-diamine |
| SMILES | CN1C=CC(N)=CC1N |
| InChI | InChI=1S/C6H11N3/c1-9-3-2-5(7)4-6(9)8/h2-4,6H,7-8H2,1H3 |
| InChIKey | RUKJKNOSURSIKE-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 55.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 125.17 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-methyl-2H-pyridine-2,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-2H-pyridine-2,4-diamine?
The IUPAC name of 1-methyl-2H-pyridine-2,4-diamine (CID 152784170) is 1-methyl-2H-pyridine-2,4-diamine.
What is the SMILES notation for 1-methyl-2H-pyridine-2,4-diamine?
The canonical SMILES for 1-methyl-2H-pyridine-2,4-diamine is CN1C=CC(N)=CC1N.
What is the InChIKey of 1-methyl-2H-pyridine-2,4-diamine?
The InChIKey is RUKJKNOSURSIKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11N3/c1-9-3-2-5(7)4-6(9)8/h2-4,6H,7-8H2,1H3.
What are the key properties of 1-methyl-2H-pyridine-2,4-diamine?
1-methyl-2H-pyridine-2,4-diamine has a molecular weight of 125.17 g/mol, XLogP of -0.43, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-2H-pyridine-2,4-diamine is sourced from PubChem (CID 152784170), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).