C27H39FN2O2 — CID 152785222
8-[1-cyclobutyl-6-(1-cyclopropyl-1-methoxyethyl)-4-fluorobenzimidazol-2-yl]-2,2-dimethyloctan-4-one (PubChem CID 152785222) has the molecular formula C27H39FN2O2 and a molecular weight of 442.62 g/mol. Its IUPAC name is 8-[1-cyclobutyl-6-(1-cyclopropyl-1-methoxyethyl)-4-fluorobenzimidazol-2-yl]-2,2-dimethyloctan-4-one.
| Compound Name | 8-[1-cyclobutyl-6-(1-cyclopropyl-1-methoxyethyl)-4-fluorobenzimidazol-2-yl]-2,2-dimethyloctan-4-one |
|---|---|
| PubChem CID | 152785222 |
| Molecular Formula | C27H39FN2O2 |
| Molecular Weight | 442.62 g/mol |
| Exact Mass | 442.30 |
| IUPAC Name | 8-[1-cyclobutyl-6-(1-cyclopropyl-1-methoxyethyl)-4-fluorobenzimidazol-2-yl]-2,2-dimethyloctan-4-one |
| SMILES | COC(C)(c1cc(F)c2nc(CCCCC(=O)CC(C)(C)C)n(C3CCC3)c2c1)C1CC1 |
| InChI | InChI=1S/C27H39FN2O2/c1-26(2,3)17-21(31)11-6-7-12-24-29-25-22(28)15-19(27(4,32-5)18-13-14-18)16-23(25)30(24)20-9-8-10-20/h15-16,18,20H,6-14,17H2,1-5H3 |
| InChIKey | RURQOGKFOFQAST-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.62 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|