C17H26I2N3O2- — CID 152785997
CID 152785997 (PubChem CID 152785997) has the molecular formula C17H26I2N3O2- and a molecular weight of 558.22 g/mol.
| Compound Name | CID 152785997 |
|---|---|
| PubChem CID | 152785997 |
| Molecular Formula | C17H26I2N3O2- |
| Molecular Weight | 558.22 g/mol |
| Exact Mass | 558.01 |
| IUPAC Name | — |
| SMILES | CCC(C)C1(OC(=O)C2(C34NI3N4)N[I-]2)CC2CCC1C1CCC21 |
| InChI | InChI=1S/C17H26I2N3O2/c1-3-9(2)15(8-10-4-7-13(15)12-6-5-11(10)12)24-14(23)16(18-20-16)17-19(21-17)22-17/h9-13,20-22H,3-8H2,1-2H3/q-1 |
| InChIKey | QOZSISRHTJFIBY-UHFFFAOYSA-N |
| XLogP | -0.73 |
| TPSA | 92.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.22 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|