C22H14ClF4NO2 — CID 15278890
4-[4-[4-[chloro(difluoro)methoxy]phenyl]phenyl]-2-(2,6-difluorophenyl)-4,5-dihydro-1,3-oxazole (PubChem CID 15278890) has the molecular formula C22H14ClF4NO2 and a molecular weight of 435.80 g/mol. Its IUPAC name is 4-[4-[4-[chloro(difluoro)methoxy]phenyl]phenyl]-2-(2,6-difluorophenyl)-4,5-dihydro-1,3-oxazole.
| Compound Name | 4-[4-[4-[chloro(difluoro)methoxy]phenyl]phenyl]-2-(2,6-difluorophenyl)-4,5-dihydro-1,3-oxazole |
|---|---|
| PubChem CID | 15278890 |
| Molecular Formula | C22H14ClF4NO2 |
| Molecular Weight | 435.80 g/mol |
| Exact Mass | 435.06 |
| IUPAC Name | 4-[4-[4-[chloro(difluoro)methoxy]phenyl]phenyl]-2-(2,6-difluorophenyl)-4,5-dihydro-1,3-oxazole |
| SMILES | Fc1cccc(F)c1C1=NC(c2ccc(-c3ccc(OC(F)(F)Cl)cc3)cc2)CO1 |
| InChI | InChI=1S/C22H14ClF4NO2/c23-22(26,27)30-16-10-8-14(9-11-16)13-4-6-15(7-5-13)19-12-29-21(28-19)20-17(24)2-1-3-18(20)25/h1-11,19H,12H2 |
| InChIKey | MMKMZYAAFPRLDW-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.80 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|