C7H9NO5S2 — CID 152789365
2-methoxy-5-(sulfinoamino)benzenesulfinic acid (PubChem CID 152789365) has the molecular formula C7H9NO5S2 and a molecular weight of 251.28 g/mol. Its IUPAC name is 2-methoxy-5-(sulfinoamino)benzenesulfinic acid.
| Compound Name | 2-methoxy-5-(sulfinoamino)benzenesulfinic acid |
|---|---|
| PubChem CID | 152789365 |
| Molecular Formula | C7H9NO5S2 |
| Molecular Weight | 251.28 g/mol |
| Exact Mass | 250.99 |
| IUPAC Name | 2-methoxy-5-(sulfinoamino)benzenesulfinic acid |
| SMILES | COc1ccc(NS(=O)O)cc1S(=O)O |
| InChI | InChI=1S/C7H9NO5S2/c1-13-6-3-2-5(8-15(11)12)4-7(6)14(9)10/h2-4,8H,1H3,(H,9,10)(H,11,12) |
| InChIKey | CCJHRPNDWMVDPO-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.28 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|