C11H5F5N2S — CID 15279027
2-[(2,3,4,5,6-pentafluorophenyl)methylsulfanyl]pyrimidine (PubChem CID 15279027) has the molecular formula C11H5F5N2S and a molecular weight of 292.23 g/mol. Its IUPAC name is 2-[(2,3,4,5,6-pentafluorophenyl)methylsulfanyl]pyrimidine.
| Compound Name | 2-[(2,3,4,5,6-pentafluorophenyl)methylsulfanyl]pyrimidine |
|---|---|
| PubChem CID | 15279027 |
| Molecular Formula | C11H5F5N2S |
| Molecular Weight | 292.23 g/mol |
| Exact Mass | 292.01 |
| IUPAC Name | 2-[(2,3,4,5,6-pentafluorophenyl)methylsulfanyl]pyrimidine |
| SMILES | Fc1c(F)c(F)c(CSc2ncccn2)c(F)c1F |
| InChI | InChI=1S/C11H5F5N2S/c12-6-5(4-19-11-17-2-1-3-18-11)7(13)9(15)10(16)8(6)14/h1-3H,4H2 |
| InChIKey | HVQKVUFECWIKFD-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.23 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|