About N-methyl-1-(2-methyl-1,3-dihydrotetrazol-5-yl)methanamine
N-methyl-1-(2-methyl-1,3-dihydrotetrazol-5-yl)methanamine (PubChem CID 152790694) has the molecular formula C4H11N5
and a molecular weight of 129.17 g/mol. Its IUPAC name is N-methyl-1-(2-methyl-1,3-dihydrotetrazol-5-yl)methanamine.
Molecular Properties
| Compound Name | N-methyl-1-(2-methyl-1,3-dihydrotetrazol-5-yl)methanamine |
| PubChem CID | 152790694 |
| Molecular Formula | C4H11N5 |
| Molecular Weight | 129.17 g/mol |
| Exact Mass | 129.10 |
| IUPAC Name | N-methyl-1-(2-methyl-1,3-dihydrotetrazol-5-yl)methanamine |
| SMILES | CNCC1=NNN(C)N1 |
| InChI | InChI=1S/C4H11N5/c1-5-3-4-6-8-9(2)7-4/h5,8H,3H2,1-2H3,(H,6,7) |
| InChIKey | SHHAQBRVIHGOGD-UHFFFAOYSA-N |
| XLogP | -1.53 |
| TPSA | 51.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 129.17 |
| LogP ≤ 5 | -1.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-methyl-1-(2-methyl-1,3-dihydrotetrazol-5-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-1-(2-methyl-1,3-dihydrotetrazol-5-yl)methanamine?
The IUPAC name of N-methyl-1-(2-methyl-1,3-dihydrotetrazol-5-yl)methanamine (CID 152790694) is N-methyl-1-(2-methyl-1,3-dihydrotetrazol-5-yl)methanamine.
What is the SMILES notation for N-methyl-1-(2-methyl-1,3-dihydrotetrazol-5-yl)methanamine?
The canonical SMILES for N-methyl-1-(2-methyl-1,3-dihydrotetrazol-5-yl)methanamine is CNCC1=NNN(C)N1.
What is the InChIKey of N-methyl-1-(2-methyl-1,3-dihydrotetrazol-5-yl)methanamine?
The InChIKey is SHHAQBRVIHGOGD-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H11N5/c1-5-3-4-6-8-9(2)7-4/h5,8H,3H2,1-2H3,(H,6,7).
What are the key properties of N-methyl-1-(2-methyl-1,3-dihydrotetrazol-5-yl)methanamine?
N-methyl-1-(2-methyl-1,3-dihydrotetrazol-5-yl)methanamine has a molecular weight of 129.17 g/mol, XLogP of -1.53, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-1-(2-methyl-1,3-dihydrotetrazol-5-yl)methanamine is sourced from PubChem (CID 152790694), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).