C18H27N3O2 — CID 15279357
N-butoxy-4-(5,6,7,8-tetrahydroquinazolin-4-yloxy)cyclohexan-1-imine (PubChem CID 15279357) has the molecular formula C18H27N3O2 and a molecular weight of 317.43 g/mol. Its IUPAC name is N-butoxy-4-(5,6,7,8-tetrahydroquinazolin-4-yloxy)cyclohexan-1-imine.
| Compound Name | N-butoxy-4-(5,6,7,8-tetrahydroquinazolin-4-yloxy)cyclohexan-1-imine |
|---|---|
| PubChem CID | 15279357 |
| Molecular Formula | C18H27N3O2 |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.21 |
| IUPAC Name | N-butoxy-4-(5,6,7,8-tetrahydroquinazolin-4-yloxy)cyclohexan-1-imine |
| SMILES | CCCCON=C1CCC(Oc2ncnc3c2CCCC3)CC1 |
| InChI | InChI=1S/C18H27N3O2/c1-2-3-12-22-21-14-8-10-15(11-9-14)23-18-16-6-4-5-7-17(16)19-13-20-18/h13,15H,2-12H2,1H3/b21-14- |
| InChIKey | XCMBXMOUCQQWOV-STZFKDTASA-N |
| XLogP | 3.85 |
| TPSA | 56.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|