C19H22N4O4 — CID 152794499
tert-butyl 2-[6-[6-(cyclopropanecarbonylamino)pyrimidin-4-yl]oxy-3-pyridinyl]acetate (PubChem CID 152794499) has the molecular formula C19H22N4O4 and a molecular weight of 370.41 g/mol. Its IUPAC name is tert-butyl 2-[6-[6-(cyclopropanecarbonylamino)pyrimidin-4-yl]oxy-3-pyridinyl]acetate.
| Compound Name | tert-butyl 2-[6-[6-(cyclopropanecarbonylamino)pyrimidin-4-yl]oxy-3-pyridinyl]acetate |
|---|---|
| PubChem CID | 152794499 |
| Molecular Formula | C19H22N4O4 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.16 |
| IUPAC Name | tert-butyl 2-[6-[6-(cyclopropanecarbonylamino)pyrimidin-4-yl]oxy-3-pyridinyl]acetate |
| SMILES | CC(C)(C)OC(=O)Cc1ccc(Oc2cc(NC(=O)C3CC3)ncn2)nc1 |
| InChI | InChI=1S/C19H22N4O4/c1-19(2,3)27-17(24)8-12-4-7-15(20-10-12)26-16-9-14(21-11-22-16)23-18(25)13-5-6-13/h4,7,9-11,13H,5-6,8H2,1-3H3,(H,21,22,23,25) |
| InChIKey | SLATWXBJLDPJGX-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 103.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |