C15H21N3O7 — CID 15279667
[(3R,4R,5R,6R)-4,5-diacetyloxy-6-(azidomethyl)-2-prop-2-enyloxan-3-yl] acetate (PubChem CID 15279667) has the molecular formula C15H21N3O7 and a molecular weight of 355.35 g/mol. Its IUPAC name is [(3R,4R,5R,6R)-4,5-diacetyloxy-6-(azidomethyl)-2-prop-2-enyloxan-3-yl] acetate.
| Compound Name | [(3R,4R,5R,6R)-4,5-diacetyloxy-6-(azidomethyl)-2-prop-2-enyloxan-3-yl] acetate |
|---|---|
| PubChem CID | 15279667 |
| Molecular Formula | C15H21N3O7 |
| Molecular Weight | 355.35 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | [(3R,4R,5R,6R)-4,5-diacetyloxy-6-(azidomethyl)-2-prop-2-enyloxan-3-yl] acetate |
| SMILES | C=CCC1O[C@H](CN=[N+]=[N-])[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C15H21N3O7/c1-5-6-11-13(22-8(2)19)15(24-10(4)21)14(23-9(3)20)12(25-11)7-17-18-16/h5,11-15H,1,6-7H2,2-4H3/t11?,12-,13-,14-,15-/m1/s1 |
| InChIKey | OOZFOXUGDCNIQH-XSISWNRUSA-N |
| XLogP | 1.44 |
| TPSA | 136.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.35 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|