C9H10F2O2 — CID 152797213
6-ethyl-2,2-difluoro-4,5-dihydro-1,3-benzodioxole (PubChem CID 152797213) has the molecular formula C9H10F2O2 and a molecular weight of 188.17 g/mol. Its IUPAC name is 6-ethyl-2,2-difluoro-4,5-dihydro-1,3-benzodioxole.
| Compound Name | 6-ethyl-2,2-difluoro-4,5-dihydro-1,3-benzodioxole |
|---|---|
| PubChem CID | 152797213 |
| Molecular Formula | C9H10F2O2 |
| Molecular Weight | 188.17 g/mol |
| Exact Mass | 188.06 |
| IUPAC Name | 6-ethyl-2,2-difluoro-4,5-dihydro-1,3-benzodioxole |
| SMILES | CCC1=CC2=C(CC1)OC(F)(F)O2 |
| InChI | InChI=1S/C9H10F2O2/c1-2-6-3-4-7-8(5-6)13-9(10,11)12-7/h5H,2-4H2,1H3 |
| InChIKey | SMJQCMVZTFRBFS-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.17 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |