C26H31F2N3O2 — CID 152800226
2-[(1S,3S)-3-amino-2,2,3-trimethylcyclopentyl]-1-[8-[(2,6-difluorophenyl)methoxy]-2,6-dimethylimidazo[1,2-a]pyridin-3-yl]ethanone (PubChem CID 152800226) has the molecular formula C26H31F2N3O2 and a molecular weight of 455.55 g/mol. Its IUPAC name is 2-[(1S,3S)-3-amino-2,2,3-trimethylcyclopentyl]-1-[8-[(2,6-difluorophenyl)methoxy]-2,6-dimethylimidazo[1,2-a]pyridin-3-yl]ethanone.
| Compound Name | 2-[(1S,3S)-3-amino-2,2,3-trimethylcyclopentyl]-1-[8-[(2,6-difluorophenyl)methoxy]-2,6-dimethylimidazo[1,2-a]pyridin-3-yl]ethanone |
|---|---|
| PubChem CID | 152800226 |
| Molecular Formula | C26H31F2N3O2 |
| Molecular Weight | 455.55 g/mol |
| Exact Mass | 455.24 |
| IUPAC Name | 2-[(1S,3S)-3-amino-2,2,3-trimethylcyclopentyl]-1-[8-[(2,6-difluorophenyl)methoxy]-2,6-dimethylimidazo[1,2-a]pyridin-3-yl]ethanone |
| SMILES | Cc1cc(OCc2c(F)cccc2F)c2nc(C)c(C(=O)C[C@@H]3CC[C@](C)(N)C3(C)C)n2c1 |
| InChI | InChI=1S/C26H31F2N3O2/c1-15-11-22(33-14-18-19(27)7-6-8-20(18)28)24-30-16(2)23(31(24)13-15)21(32)12-17-9-10-26(5,29)25(17,3)4/h6-8,11,13,17H,9-10,12,14,29H2,1-5H3/t17-,26-/m0/s1 |
| InChIKey | SNFRKHGBPXFSMS-QLXKLKPCSA-N |
| XLogP | 5.53 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.55 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |