C11H24N2OSi2 — CID 15280063
1,3-bis(trimethylsilyl)-4,7-dihydro-1,3-diazepin-2-one (PubChem CID 15280063) has the molecular formula C11H24N2OSi2 and a molecular weight of 256.50 g/mol. Its IUPAC name is 1,3-bis(trimethylsilyl)-4,7-dihydro-1,3-diazepin-2-one.
| Compound Name | 1,3-bis(trimethylsilyl)-4,7-dihydro-1,3-diazepin-2-one |
|---|---|
| PubChem CID | 15280063 |
| Molecular Formula | C11H24N2OSi2 |
| Molecular Weight | 256.50 g/mol |
| Exact Mass | 256.14 |
| IUPAC Name | 1,3-bis(trimethylsilyl)-4,7-dihydro-1,3-diazepin-2-one |
| SMILES | C[Si](C)(C)N1CC=CCN([Si](C)(C)C)C1=O |
| InChI | InChI=1S/C11H24N2OSi2/c1-15(2,3)12-9-7-8-10-13(11(12)14)16(4,5)6/h7-8H,9-10H2,1-6H3 |
| InChIKey | SQABTMQOSHULMJ-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.50 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|