C26H23F6N3O4 — CID 152802342
3-[[2-[(2E,4E)-4-(trifluoromethoxy)hexa-2,4-dien-2-yl]-1-[[3-(trifluoromethyl)phenyl]methyl]benzimidazole-5-carbonyl]amino]propanoic acid (PubChem CID 152802342) has the molecular formula C26H23F6N3O4 and a molecular weight of 555.48 g/mol. Its IUPAC name is 3-[[2-[(2E,4E)-4-(trifluoromethoxy)hexa-2,4-dien-2-yl]-1-[[3-(trifluoromethyl)phenyl]methyl]benzimidazole-5-carbonyl]amino]propanoic acid.
| Compound Name | 3-[[2-[(2E,4E)-4-(trifluoromethoxy)hexa-2,4-dien-2-yl]-1-[[3-(trifluoromethyl)phenyl]methyl]benzimidazole-5-carbonyl]amino]propanoic acid |
|---|---|
| PubChem CID | 152802342 |
| Molecular Formula | C26H23F6N3O4 |
| Molecular Weight | 555.48 g/mol |
| Exact Mass | 555.16 |
| IUPAC Name | 3-[[2-[(2E,4E)-4-(trifluoromethoxy)hexa-2,4-dien-2-yl]-1-[[3-(trifluoromethyl)phenyl]methyl]benzimidazole-5-carbonyl]amino]propanoic acid |
| SMILES | C/C=C(\C=C(/C)c1nc2cc(C(=O)NCCC(=O)O)ccc2n1Cc1cccc(C(F)(F)F)c1)OC(F)(F)F |
| InChI | InChI=1S/C26H23F6N3O4/c1-3-19(39-26(30,31)32)11-15(2)23-34-20-13-17(24(38)33-10-9-22(36)37)7-8-21(20)35(23)14-16-5-4-6-18(12-16)25(27,28)29/h3-8,11-13H,9-10,14H2,1-2H3,(H,33,38)(H,36,37)/b15-11+,19-3+ |
| InChIKey | SOGLBHNPXVRFFE-AHXHDLPBSA-N |
| XLogP | 6.15 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.48 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|