C28H31ClN7O8P — CID 152803050
[(2R,4S,5R)-5-[2-amino-7-[2-(4-chlorophenoxy)ethyl]-6-oxo-1H-purin-9-ium-9-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-[2-(1H-indol-3-yl)ethylamino]phosphinate (PubChem CID 152803050) has the molecular formula C28H31ClN7O8P and a molecular weight of 660.02 g/mol. Its IUPAC name is [(2R,4S,5R)-5-[2-amino-7-[2-(4-chlorophenoxy)ethyl]-6-oxo-1H-purin-9-ium-9-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-[2-(1H-indol-3-yl)ethylamino]phosphinate.
| Compound Name | [(2R,4S,5R)-5-[2-amino-7-[2-(4-chlorophenoxy)ethyl]-6-oxo-1H-purin-9-ium-9-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-[2-(1H-indol-3-yl)ethylamino]phosphinate |
|---|---|
| PubChem CID | 152803050 |
| Molecular Formula | C28H31ClN7O8P |
| Molecular Weight | 660.02 g/mol |
| Exact Mass | 659.17 |
| IUPAC Name | [(2R,4S,5R)-5-[2-amino-7-[2-(4-chlorophenoxy)ethyl]-6-oxo-1H-purin-9-ium-9-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-[2-(1H-indol-3-yl)ethylamino]phosphinate |
| SMILES | Nc1nc2c(c(=O)[nH]1)n(CCOc1ccc(Cl)cc1)c[n+]2[C@@H]1O[C@H](COP(=O)([O-])NCCc2c[nH]c3ccccc23)C(O)[C@@H]1O |
| InChI | InChI=1S/C28H31ClN7O8P/c29-17-5-7-18(8-6-17)42-12-11-35-15-36(25-22(35)26(39)34-28(30)33-25)27-24(38)23(37)21(44-27)14-43-45(40,41)32-10-9-16-13-31-20-4-2-1-3-19(16)20/h1-8,13,15,21,23-24,27,31,37-38H,9-12,14H2,(H4-,30,32,33,34,39,40,41)/t21-,23?,24+,27-/m1/s1 |
| InChIKey | SOOPOYRKODFSCR-UOXSXUMGSA-N |
| XLogP | 0.74 |
| TPSA | 216.68 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.02 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|