C21H25FO4 — CID 152803135
4-[4-(3-fluorooxetan-3-yl)-2-oxobutyl]-2-(2,4,6-trimethylphenyl)cyclopentane-1,3-dione (PubChem CID 152803135) has the molecular formula C21H25FO4 and a molecular weight of 360.43 g/mol. Its IUPAC name is 4-[4-(3-fluorooxetan-3-yl)-2-oxobutyl]-2-(2,4,6-trimethylphenyl)cyclopentane-1,3-dione.
| Compound Name | 4-[4-(3-fluorooxetan-3-yl)-2-oxobutyl]-2-(2,4,6-trimethylphenyl)cyclopentane-1,3-dione |
|---|---|
| PubChem CID | 152803135 |
| Molecular Formula | C21H25FO4 |
| Molecular Weight | 360.43 g/mol |
| Exact Mass | 360.17 |
| IUPAC Name | 4-[4-(3-fluorooxetan-3-yl)-2-oxobutyl]-2-(2,4,6-trimethylphenyl)cyclopentane-1,3-dione |
| SMILES | Cc1cc(C)c(C2C(=O)CC(CC(=O)CCC3(F)COC3)C2=O)c(C)c1 |
| InChI | InChI=1S/C21H25FO4/c1-12-6-13(2)18(14(3)7-12)19-17(24)9-15(20(19)25)8-16(23)4-5-21(22)10-26-11-21/h6-7,15,19H,4-5,8-11H2,1-3H3 |
| InChIKey | SOPAFXVXIMEEEX-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.43 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|