About tert-butyl-dimethyl-[(3S,5R)-5-methylnon-1-yn-3-yl]oxysilane
tert-butyl-dimethyl-[(3S,5R)-5-methylnon-1-yn-3-yl]oxysilane (PubChem CID 15280327) has the molecular formula C16H32OSi
and a molecular weight of 268.52 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(3S,5R)-5-methylnon-1-yn-3-yl]oxysilane.
Molecular Properties
| Compound Name | tert-butyl-dimethyl-[(3S,5R)-5-methylnon-1-yn-3-yl]oxysilane |
| PubChem CID | 15280327 |
| Molecular Formula | C16H32OSi |
| Molecular Weight | 268.52 g/mol |
| Exact Mass | 268.22 |
| IUPAC Name | tert-butyl-dimethyl-[(3S,5R)-5-methylnon-1-yn-3-yl]oxysilane |
| SMILES | C#C[C@H](C[C@H](C)CCCC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C16H32OSi/c1-9-11-12-14(3)13-15(10-2)17-18(7,8)16(4,5)6/h2,14-15H,9,11-13H2,1,3-8H3/t14-,15-/m1/s1 |
| InChIKey | JLZODEVNYCZFMH-HUUCEWRRSA-N |
| XLogP | 5.23 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 268.52 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl-dimethyl-[(3S,5R)-5-methylnon-1-yn-3-yl]oxysilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl-dimethyl-[(3S,5R)-5-methylnon-1-yn-3-yl]oxysilane?
The IUPAC name of tert-butyl-dimethyl-[(3S,5R)-5-methylnon-1-yn-3-yl]oxysilane (CID 15280327) is tert-butyl-dimethyl-[(3S,5R)-5-methylnon-1-yn-3-yl]oxysilane.
What is the SMILES notation for tert-butyl-dimethyl-[(3S,5R)-5-methylnon-1-yn-3-yl]oxysilane?
The canonical SMILES for tert-butyl-dimethyl-[(3S,5R)-5-methylnon-1-yn-3-yl]oxysilane is C#C[C@H](C[C@H](C)CCCC)O[Si](C)(C)C(C)(C)C.
What is the InChIKey of tert-butyl-dimethyl-[(3S,5R)-5-methylnon-1-yn-3-yl]oxysilane?
The InChIKey is JLZODEVNYCZFMH-HUUCEWRRSA-N. The full InChI is InChI=1S/C16H32OSi/c1-9-11-12-14(3)13-15(10-2)17-18(7,8)16(4,5)6/h2,14-15H,9,11-13H2,1,3-8H3/t14-,15-/m1/s1.
What are the key properties of tert-butyl-dimethyl-[(3S,5R)-5-methylnon-1-yn-3-yl]oxysilane?
tert-butyl-dimethyl-[(3S,5R)-5-methylnon-1-yn-3-yl]oxysilane has a molecular weight of 268.52 g/mol, XLogP of 5.23, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl-dimethyl-[(3S,5R)-5-methylnon-1-yn-3-yl]oxysilane is sourced from PubChem (CID 15280327), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).