C30H54O3Si2 — CID 15280332
cis-(3R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-3-[(3S,5S)-3-[tert-butyl(dimethyl)silyl]oxy-5,9-dimethyldec-8-en-1-ynyl]-2-methylidenecyclopentan-1-one (PubChem CID 15280332) has the molecular formula C30H54O3Si2 and a molecular weight of 518.93 g/mol. Its IUPAC name is cis-(3R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-3-[(3S,5S)-3-[tert-butyl(dimethyl)silyl]oxy-5,9-dimethyldec-8-en-1-ynyl]-2-methylidenecyclopentan-1-one.
| Compound Name | cis-(3R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-3-[(3S,5S)-3-[tert-butyl(dimethyl)silyl]oxy-5,9-dimethyldec-8-en-1-ynyl]-2-methylidenecyclopentan-1-one |
|---|---|
| PubChem CID | 15280332 |
| Molecular Formula | C30H54O3Si2 |
| Molecular Weight | 518.93 g/mol |
| Exact Mass | 518.36 |
| IUPAC Name | cis-(3R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-3-[(3S,5S)-3-[tert-butyl(dimethyl)silyl]oxy-5,9-dimethyldec-8-en-1-ynyl]-2-methylidenecyclopentan-1-one |
| SMILES | C=C1C(=O)C[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1C#C[C@H](C[C@@H](C)CCC=C(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C30H54O3Si2/c1-22(2)16-15-17-23(3)20-25(32-34(11,12)29(5,6)7)18-19-26-24(4)27(31)21-28(26)33-35(13,14)30(8,9)10/h16,23,25-26,28H,4,15,17,20-21H2,1-3,5-14H3/t23-,25+,26+,28+/m0/s1 |
| InChIKey | WKMRXBAUBBMSKK-HDEUIXPWSA-N |
| XLogP | 8.69 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.93 |
| LogP ≤ 5 | 8.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|