C42H41N3O — CID 152804782
2,4-di(cyclohexa-2,4-dien-1-yl)-6-[7-[4-(9,9-dimethyl-2,3,7,8-tetrahydrofluoren-2-yl)phenyl]-2,7-dihydrooxepin-4-yl]-1,3,5-triazine (PubChem CID 152804782) has the molecular formula C42H41N3O and a molecular weight of 603.81 g/mol. Its IUPAC name is 2,4-di(cyclohexa-2,4-dien-1-yl)-6-[7-[4-(9,9-dimethyl-2,3,7,8-tetrahydrofluoren-2-yl)phenyl]-2,7-dihydrooxepin-4-yl]-1,3,5-triazine.
| Compound Name | 2,4-di(cyclohexa-2,4-dien-1-yl)-6-[7-[4-(9,9-dimethyl-2,3,7,8-tetrahydrofluoren-2-yl)phenyl]-2,7-dihydrooxepin-4-yl]-1,3,5-triazine |
|---|---|
| PubChem CID | 152804782 |
| Molecular Formula | C42H41N3O |
| Molecular Weight | 603.81 g/mol |
| Exact Mass | 603.32 |
| IUPAC Name | 2,4-di(cyclohexa-2,4-dien-1-yl)-6-[7-[4-(9,9-dimethyl-2,3,7,8-tetrahydrofluoren-2-yl)phenyl]-2,7-dihydrooxepin-4-yl]-1,3,5-triazine |
| SMILES | CC1(C)C2=CC(c3ccc(C4C=CC(c5nc(C6C=CC=CC6)nc(C6C=CC=CC6)n5)=CCO4)cc3)CC=C2C2=C1CCC=C2 |
| InChI | InChI=1S/C42H41N3O/c1-42(2)36-16-10-9-15-34(36)35-23-21-33(27-37(35)42)28-17-19-29(20-18-28)38-24-22-32(25-26-46-38)41-44-39(30-11-5-3-6-12-30)43-40(45-41)31-13-7-4-8-14-31/h3-9,11,13,15,17-20,22-25,27,30-31,33,38H,10,12,14,16,21,26H2,1-2H3 |
| InChIKey | SPBWHBAYVDPKNE-UHFFFAOYSA-N |
| XLogP | 9.81 |
| TPSA | 47.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.81 |
| LogP ≤ 5 | 9.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |