About tert-butyl N-[(2S,3R)-3-hydroxy-4-nitro-1-phenylbutan-2-yl]carbamate
tert-butyl N-[(2S,3R)-3-hydroxy-4-nitro-1-phenylbutan-2-yl]carbamate (PubChem CID 15280624) has the molecular formula C15H22N2O5
and a molecular weight of 310.35 g/mol. Its IUPAC name is tert-butyl N-[(2S,3R)-3-hydroxy-4-nitro-1-phenylbutan-2-yl]carbamate.
Molecular Properties
| Compound Name | tert-butyl N-[(2S,3R)-3-hydroxy-4-nitro-1-phenylbutan-2-yl]carbamate |
| PubChem CID | 15280624 |
| Molecular Formula | C15H22N2O5 |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.15 |
| IUPAC Name | tert-butyl N-[(2S,3R)-3-hydroxy-4-nitro-1-phenylbutan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](Cc1ccccc1)[C@H](O)C[N+](=O)[O-] |
| InChI | InChI=1S/C15H22N2O5/c1-15(2,3)22-14(19)16-12(13(18)10-17(20)21)9-11-7-5-4-6-8-11/h4-8,12-13,18H,9-10H2,1-3H3,(H,16,19)/t12-,13+/m0/s1 |
| InChIKey | WAEZXLPMZDLZJT-QWHCGFSZSA-N |
| XLogP | 1.76 |
| TPSA | 101.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl N-[(2S,3R)-3-hydroxy-4-nitro-1-phenylbutan-2-yl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[(2S,3R)-3-hydroxy-4-nitro-1-phenylbutan-2-yl]carbamate?
The IUPAC name of tert-butyl N-[(2S,3R)-3-hydroxy-4-nitro-1-phenylbutan-2-yl]carbamate (CID 15280624) is tert-butyl N-[(2S,3R)-3-hydroxy-4-nitro-1-phenylbutan-2-yl]carbamate.
What is the SMILES notation for tert-butyl N-[(2S,3R)-3-hydroxy-4-nitro-1-phenylbutan-2-yl]carbamate?
The canonical SMILES for tert-butyl N-[(2S,3R)-3-hydroxy-4-nitro-1-phenylbutan-2-yl]carbamate is CC(C)(C)OC(=O)N[C@@H](Cc1ccccc1)[C@H](O)C[N+](=O)[O-].
What is the InChIKey of tert-butyl N-[(2S,3R)-3-hydroxy-4-nitro-1-phenylbutan-2-yl]carbamate?
The InChIKey is WAEZXLPMZDLZJT-QWHCGFSZSA-N. The full InChI is InChI=1S/C15H22N2O5/c1-15(2,3)22-14(19)16-12(13(18)10-17(20)21)9-11-7-5-4-6-8-11/h4-8,12-13,18H,9-10H2,1-3H3,(H,16,19)/t12-,13+/m0/s1.
What are the key properties of tert-butyl N-[(2S,3R)-3-hydroxy-4-nitro-1-phenylbutan-2-yl]carbamate?
tert-butyl N-[(2S,3R)-3-hydroxy-4-nitro-1-phenylbutan-2-yl]carbamate has a molecular weight of 310.35 g/mol, XLogP of 1.76, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[(2S,3R)-3-hydroxy-4-nitro-1-phenylbutan-2-yl]carbamate is sourced from PubChem (CID 15280624), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).