C25H33BFN3O2 — CID 152806907
N-[amino-(4-tert-butylphenyl)methylidene]-2-fluoro-N'-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzenecarboximidamide (PubChem CID 152806907) has the molecular formula C25H33BFN3O2 and a molecular weight of 437.37 g/mol. Its IUPAC name is N-[amino-(4-tert-butylphenyl)methylidene]-2-fluoro-N'-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzenecarboximidamide.
| Compound Name | N-[amino-(4-tert-butylphenyl)methylidene]-2-fluoro-N'-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzenecarboximidamide |
|---|---|
| PubChem CID | 152806907 |
| Molecular Formula | C25H33BFN3O2 |
| Molecular Weight | 437.37 g/mol |
| Exact Mass | 437.26 |
| IUPAC Name | N-[amino-(4-tert-butylphenyl)methylidene]-2-fluoro-N'-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzenecarboximidamide |
| SMILES | C/N=C(/N=C(\N)c1ccc(C(C)(C)C)cc1)c1cc(B2OC(C)(C)C(C)(C)O2)ccc1F |
| InChI | InChI=1S/C25H33BFN3O2/c1-23(2,3)17-11-9-16(10-12-17)21(28)30-22(29-8)19-15-18(13-14-20(19)27)26-31-24(4,5)25(6,7)32-26/h9-15H,1-8H3,(H2,28,29,30) |
| InChIKey | SPRGQFUUKDDYBZ-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 69.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.37 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|