C24H20ClNO2 — CID 15281284
16,16-bis(furan-3-yl)-1-methyl-2-azoniatetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene chloride (PubChem CID 15281284) has the molecular formula C24H20ClNO2 and a molecular weight of 389.88 g/mol. Its IUPAC name is 16,16-bis(furan-3-yl)-1-methyl-2-azoniatetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene chloride.
| Compound Name | 16,16-bis(furan-3-yl)-1-methyl-2-azoniatetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene chloride |
|---|---|
| PubChem CID | 15281284 |
| Molecular Formula | C24H20ClNO2 |
| Molecular Weight | 389.88 g/mol |
| Exact Mass | 389.12 |
| IUPAC Name | 16,16-bis(furan-3-yl)-1-methyl-2-azoniatetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene chloride |
| SMILES | CC12CC(c3ccoc3)(c3ccoc3)C(c3ccccc31)c1cccc[n+]12.[Cl-] |
| InChI | InChI=1S/C24H20NO2.ClH/c1-23-16-24(17-9-12-26-14-17,18-10-13-27-15-18)22(19-6-2-3-7-20(19)23)21-8-4-5-11-25(21)23;/h2-15,22H,16H2,1H3;1H/q+1;/p-1 |
| InChIKey | AVVXZWFGWAMNDN-UHFFFAOYSA-M |
| XLogP | 1.76 |
| TPSA | 30.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.88 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|