C24H20ClNO3 — CID 15281291
16,16-bis(furan-3-yl)-6-methoxy-2-azoniatetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene chloride (PubChem CID 15281291) has the molecular formula C24H20ClNO3 and a molecular weight of 405.88 g/mol. Its IUPAC name is 16,16-bis(furan-3-yl)-6-methoxy-2-azoniatetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene chloride.
| Compound Name | 16,16-bis(furan-3-yl)-6-methoxy-2-azoniatetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene chloride |
|---|---|
| PubChem CID | 15281291 |
| Molecular Formula | C24H20ClNO3 |
| Molecular Weight | 405.88 g/mol |
| Exact Mass | 405.11 |
| IUPAC Name | 16,16-bis(furan-3-yl)-6-methoxy-2-azoniatetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene chloride |
| SMILES | COc1ccc[n+]2c1C1c3ccccc3C2CC1(c1ccoc1)c1ccoc1.[Cl-] |
| InChI | InChI=1S/C24H20NO3.ClH/c1-26-21-7-4-10-25-20-13-24(16-8-11-27-14-16,17-9-12-28-15-17)22(23(21)25)19-6-3-2-5-18(19)20;/h2-12,14-15,20,22H,13H2,1H3;1H/q+1;/p-1 |
| InChIKey | CGZDPKYSCIKOJD-UHFFFAOYSA-M |
| XLogP | 1.60 |
| TPSA | 39.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.88 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|