C27H20ClNO2 — CID 15281303
19,19-bis(furan-3-yl)-11-azoniapentacyclo[10.6.2.02,11.03,8.013,18]icosa-2(11),3,5,7,9,13,15,17-octaene chloride (PubChem CID 15281303) has the molecular formula C27H20ClNO2 and a molecular weight of 425.92 g/mol. Its IUPAC name is 19,19-bis(furan-3-yl)-11-azoniapentacyclo[10.6.2.02,11.03,8.013,18]icosa-2(11),3,5,7,9,13,15,17-octaene chloride.
| Compound Name | 19,19-bis(furan-3-yl)-11-azoniapentacyclo[10.6.2.02,11.03,8.013,18]icosa-2(11),3,5,7,9,13,15,17-octaene chloride |
|---|---|
| PubChem CID | 15281303 |
| Molecular Formula | C27H20ClNO2 |
| Molecular Weight | 425.92 g/mol |
| Exact Mass | 425.12 |
| IUPAC Name | 19,19-bis(furan-3-yl)-11-azoniapentacyclo[10.6.2.02,11.03,8.013,18]icosa-2(11),3,5,7,9,13,15,17-octaene chloride |
| SMILES | [Cl-].c1ccc2c(c1)C1CC(c3ccoc3)(c3ccoc3)C2c2c3ccccc3cc[n+]21 |
| InChI | InChI=1S/C27H20NO2.ClH/c1-2-6-21-18(5-1)9-12-28-24-15-27(19-10-13-29-16-19,20-11-14-30-17-20)25(26(21)28)23-8-4-3-7-22(23)24;/h1-14,16-17,24-25H,15H2;1H/q+1;/p-1 |
| InChIKey | GKUUTWFGHLTRQL-UHFFFAOYSA-M |
| XLogP | 2.74 |
| TPSA | 30.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.92 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|