C23H18NO3+ — CID 15281316
16,16-bis(furan-3-yl)-2-azoniatetracyclo[6.6.2.02,7.09,14]hexadeca-2(7),3,5,9,11,13-hexaen-4-ol (PubChem CID 15281316) has the molecular formula C23H18NO3+ and a molecular weight of 356.40 g/mol. Its IUPAC name is 16,16-bis(furan-3-yl)-2-azoniatetracyclo[6.6.2.02,7.09,14]hexadeca-2(7),3,5,9,11,13-hexaen-4-ol.
| Compound Name | 16,16-bis(furan-3-yl)-2-azoniatetracyclo[6.6.2.02,7.09,14]hexadeca-2(7),3,5,9,11,13-hexaen-4-ol |
|---|---|
| PubChem CID | 15281316 |
| Molecular Formula | C23H18NO3+ |
| Molecular Weight | 356.40 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | 16,16-bis(furan-3-yl)-2-azoniatetracyclo[6.6.2.02,7.09,14]hexadeca-2(7),3,5,9,11,13-hexaen-4-ol |
| SMILES | Oc1ccc2[n+](c1)C1CC(c3ccoc3)(c3ccoc3)C2c2ccccc21 |
| InChI | InChI=1S/C23H17NO3/c25-17-5-6-20-22-19-4-2-1-3-18(19)21(24(20)12-17)11-23(22,15-7-9-26-13-15)16-8-10-27-14-16/h1-10,12-14,21-22H,11H2/p+1 |
| InChIKey | ZIZMWGCEYKQJEU-UHFFFAOYSA-O |
| XLogP | 4.29 |
| TPSA | 50.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.40 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|