C21H24F2N6OS — CID 152813187
3,6-diamino-4-(difluoromethyl)-N-[2-(4-piperazin-1-ylphenyl)ethyl]thieno[2,3-b]pyridine-2-carboxamide (PubChem CID 152813187) has the molecular formula C21H24F2N6OS and a molecular weight of 446.53 g/mol. Its IUPAC name is 3,6-diamino-4-(difluoromethyl)-N-[2-(4-piperazin-1-ylphenyl)ethyl]thieno[2,3-b]pyridine-2-carboxamide.
| Compound Name | 3,6-diamino-4-(difluoromethyl)-N-[2-(4-piperazin-1-ylphenyl)ethyl]thieno[2,3-b]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 152813187 |
| Molecular Formula | C21H24F2N6OS |
| Molecular Weight | 446.53 g/mol |
| Exact Mass | 446.17 |
| IUPAC Name | 3,6-diamino-4-(difluoromethyl)-N-[2-(4-piperazin-1-ylphenyl)ethyl]thieno[2,3-b]pyridine-2-carboxamide |
| SMILES | Nc1cc(C(F)F)c2c(N)c(C(=O)NCCc3ccc(N4CCNCC4)cc3)sc2n1 |
| InChI | InChI=1S/C21H24F2N6OS/c22-19(23)14-11-15(24)28-21-16(14)17(25)18(31-21)20(30)27-6-5-12-1-3-13(4-2-12)29-9-7-26-8-10-29/h1-4,11,19,26H,5-10,25H2,(H2,24,28)(H,27,30) |
| InChIKey | SRTMEUZKKHKITG-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 109.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.53 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|