C23H17ClFNO2 — CID 15281320
11-fluoro-16,16-bis(furan-3-yl)-2-azoniatetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9(14),10,12-hexaene chloride (PubChem CID 15281320) has the molecular formula C23H17ClFNO2 and a molecular weight of 393.85 g/mol. Its IUPAC name is 11-fluoro-16,16-bis(furan-3-yl)-2-azoniatetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9(14),10,12-hexaene chloride.
| Compound Name | 11-fluoro-16,16-bis(furan-3-yl)-2-azoniatetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9(14),10,12-hexaene chloride |
|---|---|
| PubChem CID | 15281320 |
| Molecular Formula | C23H17ClFNO2 |
| Molecular Weight | 393.85 g/mol |
| Exact Mass | 393.09 |
| IUPAC Name | 11-fluoro-16,16-bis(furan-3-yl)-2-azoniatetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9(14),10,12-hexaene chloride |
| SMILES | Fc1ccc2c(c1)C1c3cccc[n+]3C2CC1(c1ccoc1)c1ccoc1.[Cl-] |
| InChI | InChI=1S/C23H17FNO2.ClH/c24-17-4-5-18-19(11-17)22-20-3-1-2-8-25(20)21(18)12-23(22,15-6-9-26-13-15)16-7-10-27-14-16;/h1-11,13-14,21-22H,12H2;1H/q+1;/p-1 |
| InChIKey | IZMASSQXILJAHZ-UHFFFAOYSA-M |
| XLogP | 1.73 |
| TPSA | 30.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.85 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|