C23H18ClNO3 — CID 15281324
16,16-bis(furan-3-yl)-2-azoniatetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9(14),10,12-hexaen-12-ol chloride (PubChem CID 15281324) has the molecular formula C23H18ClNO3 and a molecular weight of 391.85 g/mol. Its IUPAC name is 16,16-bis(furan-3-yl)-2-azoniatetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9(14),10,12-hexaen-12-ol chloride.
| Compound Name | 16,16-bis(furan-3-yl)-2-azoniatetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9(14),10,12-hexaen-12-ol chloride |
|---|---|
| PubChem CID | 15281324 |
| Molecular Formula | C23H18ClNO3 |
| Molecular Weight | 391.85 g/mol |
| Exact Mass | 391.10 |
| IUPAC Name | 16,16-bis(furan-3-yl)-2-azoniatetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9(14),10,12-hexaen-12-ol chloride |
| SMILES | Oc1ccc2c(c1)C1CC(c3ccoc3)(c3ccoc3)C2c2cccc[n+]21.[Cl-] |
| InChI | InChI=1S/C23H17NO3.ClH/c25-17-4-5-18-19(11-17)21-12-23(15-6-9-26-13-15,16-7-10-27-14-16)22(18)20-3-1-2-8-24(20)21;/h1-11,13-14,21-22H,12H2;1H |
| InChIKey | MJETWAUWKZASRB-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 50.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.85 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|