C23H18ClNO4 — CID 15281326
16,16-bis(furan-3-yl)-2-azoniatetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9(14),10,12-hexaene-10,12-diol chloride (PubChem CID 15281326) has the molecular formula C23H18ClNO4 and a molecular weight of 407.85 g/mol. Its IUPAC name is 16,16-bis(furan-3-yl)-2-azoniatetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9(14),10,12-hexaene-10,12-diol chloride.
| Compound Name | 16,16-bis(furan-3-yl)-2-azoniatetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9(14),10,12-hexaene-10,12-diol chloride |
|---|---|
| PubChem CID | 15281326 |
| Molecular Formula | C23H18ClNO4 |
| Molecular Weight | 407.85 g/mol |
| Exact Mass | 407.09 |
| IUPAC Name | 16,16-bis(furan-3-yl)-2-azoniatetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9(14),10,12-hexaene-10,12-diol chloride |
| SMILES | Oc1cc(O)c2c(c1)C1CC(c3ccoc3)(c3ccoc3)C2c2cccc[n+]21.[Cl-] |
| InChI | InChI=1S/C23H17NO4.ClH/c25-16-9-17-19-11-23(14-4-7-27-12-14,15-5-8-28-13-15)22(21(17)20(26)10-16)18-3-1-2-6-24(18)19;/h1-10,12-13,19,22H,11H2,(H-,25,26);1H |
| InChIKey | TTZGZVNRCRPFIG-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 70.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.85 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|