About N,4-dimethyl-3-methylidene-6-oxo-5-sulfanylcyclohexa-1,4-diene-1-carboxamide
N,4-dimethyl-3-methylidene-6-oxo-5-sulfanylcyclohexa-1,4-diene-1-carboxamide (PubChem CID 152816327) has the molecular formula C10H11NO2S
and a molecular weight of 209.27 g/mol. Its IUPAC name is N,4-dimethyl-3-methylidene-6-oxo-5-sulfanylcyclohexa-1,4-diene-1-carboxamide.
Molecular Properties
| Compound Name | N,4-dimethyl-3-methylidene-6-oxo-5-sulfanylcyclohexa-1,4-diene-1-carboxamide |
| PubChem CID | 152816327 |
| Molecular Formula | C10H11NO2S |
| Molecular Weight | 209.27 g/mol |
| Exact Mass | 209.05 |
| IUPAC Name | N,4-dimethyl-3-methylidene-6-oxo-5-sulfanylcyclohexa-1,4-diene-1-carboxamide |
| SMILES | C=C1C=C(C(=O)NC)C(=O)C(S)=C1C |
| InChI | InChI=1S/C10H11NO2S/c1-5-4-7(10(13)11-3)8(12)9(14)6(5)2/h4,14H,1H2,2-3H3,(H,11,13) |
| InChIKey | SSLKCELQCLPDOX-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.27 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze N,4-dimethyl-3-methylidene-6-oxo-5-sulfanylcyclohexa-1,4-diene-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,4-dimethyl-3-methylidene-6-oxo-5-sulfanylcyclohexa-1,4-diene-1-carboxamide?
The IUPAC name of N,4-dimethyl-3-methylidene-6-oxo-5-sulfanylcyclohexa-1,4-diene-1-carboxamide (CID 152816327) is N,4-dimethyl-3-methylidene-6-oxo-5-sulfanylcyclohexa-1,4-diene-1-carboxamide.
What is the SMILES notation for N,4-dimethyl-3-methylidene-6-oxo-5-sulfanylcyclohexa-1,4-diene-1-carboxamide?
The canonical SMILES for N,4-dimethyl-3-methylidene-6-oxo-5-sulfanylcyclohexa-1,4-diene-1-carboxamide is C=C1C=C(C(=O)NC)C(=O)C(S)=C1C.
What is the InChIKey of N,4-dimethyl-3-methylidene-6-oxo-5-sulfanylcyclohexa-1,4-diene-1-carboxamide?
The InChIKey is SSLKCELQCLPDOX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11NO2S/c1-5-4-7(10(13)11-3)8(12)9(14)6(5)2/h4,14H,1H2,2-3H3,(H,11,13).
What are the key properties of N,4-dimethyl-3-methylidene-6-oxo-5-sulfanylcyclohexa-1,4-diene-1-carboxamide?
N,4-dimethyl-3-methylidene-6-oxo-5-sulfanylcyclohexa-1,4-diene-1-carboxamide has a molecular weight of 209.27 g/mol, XLogP of 1.00, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N,4-dimethyl-3-methylidene-6-oxo-5-sulfanylcyclohexa-1,4-diene-1-carboxamide is sourced from PubChem (CID 152816327), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).