C29H27N5O5 — CID 152822758
1-[1-(4-aminophenyl)-4-ethoxypyrazol-3-yl]-2-[5-(6,7-dimethoxyquinolin-4-yl)oxy-2-pyridinyl]ethanone (PubChem CID 152822758) has the molecular formula C29H27N5O5 and a molecular weight of 525.57 g/mol. Its IUPAC name is 1-[1-(4-aminophenyl)-4-ethoxypyrazol-3-yl]-2-[5-(6,7-dimethoxyquinolin-4-yl)oxy-2-pyridinyl]ethanone.
| Compound Name | 1-[1-(4-aminophenyl)-4-ethoxypyrazol-3-yl]-2-[5-(6,7-dimethoxyquinolin-4-yl)oxy-2-pyridinyl]ethanone |
|---|---|
| PubChem CID | 152822758 |
| Molecular Formula | C29H27N5O5 |
| Molecular Weight | 525.57 g/mol |
| Exact Mass | 525.20 |
| IUPAC Name | 1-[1-(4-aminophenyl)-4-ethoxypyrazol-3-yl]-2-[5-(6,7-dimethoxyquinolin-4-yl)oxy-2-pyridinyl]ethanone |
| SMILES | CCOc1cn(-c2ccc(N)cc2)nc1C(=O)Cc1ccc(Oc2ccnc3cc(OC)c(OC)cc23)cn1 |
| InChI | InChI=1S/C29H27N5O5/c1-4-38-28-17-34(20-8-5-18(30)6-9-20)33-29(28)24(35)13-19-7-10-21(16-32-19)39-25-11-12-31-23-15-27(37-3)26(36-2)14-22(23)25/h5-12,14-17H,4,13,30H2,1-3H3 |
| InChIKey | SUFPNNHCGPVZGZ-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 123.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.57 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|