C12H19N — CID 152828234
2-[(2S)-2,3-dimethylbutyl]-4-methylpyridine (PubChem CID 152828234) has the molecular formula C12H19N and a molecular weight of 177.29 g/mol. Its IUPAC name is 2-[(2S)-2,3-dimethylbutyl]-4-methylpyridine.
| Compound Name | 2-[(2S)-2,3-dimethylbutyl]-4-methylpyridine |
|---|---|
| PubChem CID | 152828234 |
| Molecular Formula | C12H19N |
| Molecular Weight | 177.29 g/mol |
| Exact Mass | 177.15 |
| IUPAC Name | 2-[(2S)-2,3-dimethylbutyl]-4-methylpyridine |
| SMILES | Cc1ccnc(C[C@H](C)C(C)C)c1 |
| InChI | InChI=1S/C12H19N/c1-9(2)11(4)8-12-7-10(3)5-6-13-12/h5-7,9,11H,8H2,1-4H3/t11-/m0/s1 |
| InChIKey | SVMZYCOSNCPYAI-NSHDSACASA-N |
| XLogP | 3.22 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.29 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |