C28H24O5S — CID 15283097
6-[[3-(4-hydroxyoxan-4-yl)phenyl]methoxy]-9-thiophen-3-yl-1H-benzo[f][2]benzofuran-3-one (PubChem CID 15283097) has the molecular formula C28H24O5S and a molecular weight of 472.56 g/mol. Its IUPAC name is 6-[[3-(4-hydroxyoxan-4-yl)phenyl]methoxy]-9-thiophen-3-yl-1H-benzo[f][2]benzofuran-3-one.
| Compound Name | 6-[[3-(4-hydroxyoxan-4-yl)phenyl]methoxy]-9-thiophen-3-yl-1H-benzo[f][2]benzofuran-3-one |
|---|---|
| PubChem CID | 15283097 |
| Molecular Formula | C28H24O5S |
| Molecular Weight | 472.56 g/mol |
| Exact Mass | 472.13 |
| IUPAC Name | 6-[[3-(4-hydroxyoxan-4-yl)phenyl]methoxy]-9-thiophen-3-yl-1H-benzo[f][2]benzofuran-3-one |
| SMILES | O=C1OCc2c1cc1cc(OCc3cccc(C4(O)CCOCC4)c3)ccc1c2-c1ccsc1 |
| InChI | InChI=1S/C28H24O5S/c29-27-24-14-20-13-22(4-5-23(20)26(25(24)16-33-27)19-6-11-34-17-19)32-15-18-2-1-3-21(12-18)28(30)7-9-31-10-8-28/h1-6,11-14,17,30H,7-10,15-16H2 |
| InChIKey | YQDBEKVRNRJDHM-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.56 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |