C9H16N2 — CID 15283251
7-methyl-2,3,3a,4,7,7a-hexahydro-1H-isoindol-4-amine (PubChem CID 15283251) has the molecular formula C9H16N2 and a molecular weight of 152.24 g/mol. Its IUPAC name is 7-methyl-2,3,3a,4,7,7a-hexahydro-1H-isoindol-4-amine.
| Compound Name | 7-methyl-2,3,3a,4,7,7a-hexahydro-1H-isoindol-4-amine |
|---|---|
| PubChem CID | 15283251 |
| Molecular Formula | C9H16N2 |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.13 |
| IUPAC Name | 7-methyl-2,3,3a,4,7,7a-hexahydro-1H-isoindol-4-amine |
| SMILES | CC1C=CC(N)C2CNCC12 |
| InChI | InChI=1S/C9H16N2/c1-6-2-3-9(10)8-5-11-4-7(6)8/h2-3,6-9,11H,4-5,10H2,1H3 |
| InChIKey | WZLAZGPMHURVPH-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|