C30H35ClN5O5+ — CID 152837104
CID 152837104 (PubChem CID 152837104) has the molecular formula C30H35ClN5O5+ and a molecular weight of 581.09 g/mol.
| Compound Name | CID 152837104 |
|---|---|
| PubChem CID | 152837104 |
| Molecular Formula | C30H35ClN5O5+ |
| Molecular Weight | 581.09 g/mol |
| Exact Mass | 580.23 |
| IUPAC Name | — |
| SMILES | COc1ncc(-c2nc3c(n2C(C)C)C(c2ccc(Cl)cc2)C(C)[N+]2(CC24CCC(C(=O)O)CC4)C3=O)c(OC)n1 |
| InChI | InChI=1S/C30H34ClN5O5/c1-16(2)35-24-22(18-6-8-20(31)9-7-18)17(3)36(15-30(36)12-10-19(11-13-30)28(38)39)27(37)23(24)33-25(35)21-14-32-29(41-5)34-26(21)40-4/h6-9,14,16-17,19,22H,10-13,15H2,1-5H3/p+1 |
| InChIKey | KXRRQDXROPXNEN-UHFFFAOYSA-O |
| XLogP | 5.11 |
| TPSA | 116.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.09 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|