About 6-propan-2-ylimidazo[1,2-b]pyridazine-8-carbonitrile
6-propan-2-ylimidazo[1,2-b]pyridazine-8-carbonitrile (PubChem CID 152839118) has the molecular formula C10H10N4
and a molecular weight of 186.22 g/mol. Its IUPAC name is 6-propan-2-ylimidazo[1,2-b]pyridazine-8-carbonitrile.
Analyze 6-propan-2-ylimidazo[1,2-b]pyridazine-8-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-propan-2-ylimidazo[1,2-b]pyridazine-8-carbonitrile?
The IUPAC name of 6-propan-2-ylimidazo[1,2-b]pyridazine-8-carbonitrile (CID 152839118) is 6-propan-2-ylimidazo[1,2-b]pyridazine-8-carbonitrile.
What is the SMILES notation for 6-propan-2-ylimidazo[1,2-b]pyridazine-8-carbonitrile?
The canonical SMILES for 6-propan-2-ylimidazo[1,2-b]pyridazine-8-carbonitrile is CC(C)c1cc(C#N)c2nccn2n1.
What is the InChIKey of 6-propan-2-ylimidazo[1,2-b]pyridazine-8-carbonitrile?
The InChIKey is SYHMLRMRGYDYLP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N4/c1-7(2)9-5-8(6-11)10-12-3-4-14(10)13-9/h3-5,7H,1-2H3.
What are the key properties of 6-propan-2-ylimidazo[1,2-b]pyridazine-8-carbonitrile?
6-propan-2-ylimidazo[1,2-b]pyridazine-8-carbonitrile has a molecular weight of 186.22 g/mol, XLogP of 1.72, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-propan-2-ylimidazo[1,2-b]pyridazine-8-carbonitrile is sourced from PubChem (CID 152839118), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).