C27H27N2O4Y- — CID 152842497
1-[2-[4,5-dimethyl-2-[(2,3,7-trimethyl-6H-naphthalen-6-id-1-yl)oxy]phenoxy]ethyl]pyrimidine-2,4-dione;yttrium (PubChem CID 152842497) has the molecular formula C27H27N2O4Y- and a molecular weight of 532.43 g/mol. Its IUPAC name is 1-[2-[4,5-dimethyl-2-[(2,3,7-trimethyl-6H-naphthalen-6-id-1-yl)oxy]phenoxy]ethyl]pyrimidine-2,4-dione;yttrium.
| Compound Name | 1-[2-[4,5-dimethyl-2-[(2,3,7-trimethyl-6H-naphthalen-6-id-1-yl)oxy]phenoxy]ethyl]pyrimidine-2,4-dione;yttrium |
|---|---|
| PubChem CID | 152842497 |
| Molecular Formula | C27H27N2O4Y- |
| Molecular Weight | 532.43 g/mol |
| Exact Mass | 532.10 |
| IUPAC Name | 1-[2-[4,5-dimethyl-2-[(2,3,7-trimethyl-6H-naphthalen-6-id-1-yl)oxy]phenoxy]ethyl]pyrimidine-2,4-dione;yttrium |
| SMILES | Cc1[c-]cc2cc(C)c(C)c(Oc3cc(C)c(C)cc3OCCn3ccc(=O)[nH]c3=O)c2c1.[Y] |
| InChI | InChI=1S/C27H27N2O4.Y/c1-16-6-7-21-13-19(4)20(5)26(22(21)12-16)33-24-15-18(3)17(2)14-23(24)32-11-10-29-9-8-25(30)28-27(29)31;/h7-9,12-15H,10-11H2,1-5H3,(H,28,30,31);/q-1; |
| InChIKey | LYGWWQMUGNEQGX-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 73.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.43 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|