C26H24ClN7O2 — CID 152844608
(2S)-1-[4-[[5-chloro-4-[2-(2-oxobut-3-enyl)anilino]pyrimidin-2-yl]amino]-3-cyanophenyl]pyrrolidine-2-carboxamide (PubChem CID 152844608) has the molecular formula C26H24ClN7O2 and a molecular weight of 501.98 g/mol. Its IUPAC name is (2S)-1-[4-[[5-chloro-4-[2-(2-oxobut-3-enyl)anilino]pyrimidin-2-yl]amino]-3-cyanophenyl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-1-[4-[[5-chloro-4-[2-(2-oxobut-3-enyl)anilino]pyrimidin-2-yl]amino]-3-cyanophenyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 152844608 |
| Molecular Formula | C26H24ClN7O2 |
| Molecular Weight | 501.98 g/mol |
| Exact Mass | 501.17 |
| IUPAC Name | (2S)-1-[4-[[5-chloro-4-[2-(2-oxobut-3-enyl)anilino]pyrimidin-2-yl]amino]-3-cyanophenyl]pyrrolidine-2-carboxamide |
| SMILES | C=CC(=O)Cc1ccccc1Nc1nc(Nc2ccc(N3CCC[C@H]3C(N)=O)cc2C#N)ncc1Cl |
| InChI | InChI=1S/C26H24ClN7O2/c1-2-19(35)13-16-6-3-4-7-21(16)31-25-20(27)15-30-26(33-25)32-22-10-9-18(12-17(22)14-28)34-11-5-8-23(34)24(29)36/h2-4,6-7,9-10,12,15,23H,1,5,8,11,13H2,(H2,29,36)(H2,30,31,32,33)/t23-/m0/s1 |
| InChIKey | SZYJLVDBYCVZRF-QHCPKHFHSA-N |
| XLogP | 4.24 |
| TPSA | 137.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.98 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|