About [4-[4-[(dimethylamino)methyl]phenyl]cyclohexyl] 2-phenylpropanoate
[4-[4-[(dimethylamino)methyl]phenyl]cyclohexyl] 2-phenylpropanoate (PubChem CID 15284553) has the molecular formula C24H31NO2
and a molecular weight of 365.52 g/mol. Its IUPAC name is [4-[4-[(dimethylamino)methyl]phenyl]cyclohexyl] 2-phenylpropanoate.
Molecular Properties
| Compound Name | [4-[4-[(dimethylamino)methyl]phenyl]cyclohexyl] 2-phenylpropanoate |
| PubChem CID | 15284553 |
| Molecular Formula | C24H31NO2 |
| Molecular Weight | 365.52 g/mol |
| Exact Mass | 365.24 |
| IUPAC Name | [4-[4-[(dimethylamino)methyl]phenyl]cyclohexyl] 2-phenylpropanoate |
| SMILES | CC(C(=O)OC1CCC(c2ccc(CN(C)C)cc2)CC1)c1ccccc1 |
| InChI | InChI=1S/C24H31NO2/c1-18(20-7-5-4-6-8-20)24(26)27-23-15-13-22(14-16-23)21-11-9-19(10-12-21)17-25(2)3/h4-12,18,22-23H,13-17H2,1-3H3 |
| InChIKey | KFCRWMKSGBFYFQ-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 365.52 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [4-[4-[(dimethylamino)methyl]phenyl]cyclohexyl] 2-phenylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[4-[(dimethylamino)methyl]phenyl]cyclohexyl] 2-phenylpropanoate?
The IUPAC name of [4-[4-[(dimethylamino)methyl]phenyl]cyclohexyl] 2-phenylpropanoate (CID 15284553) is [4-[4-[(dimethylamino)methyl]phenyl]cyclohexyl] 2-phenylpropanoate.
What is the SMILES notation for [4-[4-[(dimethylamino)methyl]phenyl]cyclohexyl] 2-phenylpropanoate?
The canonical SMILES for [4-[4-[(dimethylamino)methyl]phenyl]cyclohexyl] 2-phenylpropanoate is CC(C(=O)OC1CCC(c2ccc(CN(C)C)cc2)CC1)c1ccccc1.
What is the InChIKey of [4-[4-[(dimethylamino)methyl]phenyl]cyclohexyl] 2-phenylpropanoate?
The InChIKey is KFCRWMKSGBFYFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H31NO2/c1-18(20-7-5-4-6-8-20)24(26)27-23-15-13-22(14-16-23)21-11-9-19(10-12-21)17-25(2)3/h4-12,18,22-23H,13-17H2,1-3H3.
What are the key properties of [4-[4-[(dimethylamino)methyl]phenyl]cyclohexyl] 2-phenylpropanoate?
[4-[4-[(dimethylamino)methyl]phenyl]cyclohexyl] 2-phenylpropanoate has a molecular weight of 365.52 g/mol, XLogP of 5.12, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[4-[(dimethylamino)methyl]phenyl]cyclohexyl] 2-phenylpropanoate is sourced from PubChem (CID 15284553), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).