About [4-[4-[(dimethylamino)methyl]phenyl]cyclohexyl] 2-(3,4-dichlorophenyl)acetate
[4-[4-[(dimethylamino)methyl]phenyl]cyclohexyl] 2-(3,4-dichlorophenyl)acetate (PubChem CID 15284554) has the molecular formula C23H27Cl2NO2
and a molecular weight of 420.38 g/mol. Its IUPAC name is [4-[4-[(dimethylamino)methyl]phenyl]cyclohexyl] 2-(3,4-dichlorophenyl)acetate.
Molecular Properties
| Compound Name | [4-[4-[(dimethylamino)methyl]phenyl]cyclohexyl] 2-(3,4-dichlorophenyl)acetate |
| PubChem CID | 15284554 |
| Molecular Formula | C23H27Cl2NO2 |
| Molecular Weight | 420.38 g/mol |
| Exact Mass | 419.14 |
| IUPAC Name | [4-[4-[(dimethylamino)methyl]phenyl]cyclohexyl] 2-(3,4-dichlorophenyl)acetate |
| SMILES | CN(C)Cc1ccc(C2CCC(OC(=O)Cc3ccc(Cl)c(Cl)c3)CC2)cc1 |
| InChI | InChI=1S/C23H27Cl2NO2/c1-26(2)15-16-3-6-18(7-4-16)19-8-10-20(11-9-19)28-23(27)14-17-5-12-21(24)22(25)13-17/h3-7,12-13,19-20H,8-11,14-15H2,1-2H3 |
| InChIKey | LXGIIUPMJJBTDK-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 420.38 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [4-[4-[(dimethylamino)methyl]phenyl]cyclohexyl] 2-(3,4-dichlorophenyl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[4-[(dimethylamino)methyl]phenyl]cyclohexyl] 2-(3,4-dichlorophenyl)acetate?
The IUPAC name of [4-[4-[(dimethylamino)methyl]phenyl]cyclohexyl] 2-(3,4-dichlorophenyl)acetate (CID 15284554) is [4-[4-[(dimethylamino)methyl]phenyl]cyclohexyl] 2-(3,4-dichlorophenyl)acetate.
What is the SMILES notation for [4-[4-[(dimethylamino)methyl]phenyl]cyclohexyl] 2-(3,4-dichlorophenyl)acetate?
The canonical SMILES for [4-[4-[(dimethylamino)methyl]phenyl]cyclohexyl] 2-(3,4-dichlorophenyl)acetate is CN(C)Cc1ccc(C2CCC(OC(=O)Cc3ccc(Cl)c(Cl)c3)CC2)cc1.
What is the InChIKey of [4-[4-[(dimethylamino)methyl]phenyl]cyclohexyl] 2-(3,4-dichlorophenyl)acetate?
The InChIKey is LXGIIUPMJJBTDK-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H27Cl2NO2/c1-26(2)15-16-3-6-18(7-4-16)19-8-10-20(11-9-19)28-23(27)14-17-5-12-21(24)22(25)13-17/h3-7,12-13,19-20H,8-11,14-15H2,1-2H3.
What are the key properties of [4-[4-[(dimethylamino)methyl]phenyl]cyclohexyl] 2-(3,4-dichlorophenyl)acetate?
[4-[4-[(dimethylamino)methyl]phenyl]cyclohexyl] 2-(3,4-dichlorophenyl)acetate has a molecular weight of 420.38 g/mol, XLogP of 5.87, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[4-[(dimethylamino)methyl]phenyl]cyclohexyl] 2-(3,4-dichlorophenyl)acetate is sourced from PubChem (CID 15284554), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).