About N-(6-methoxy-2-oxo-1-phenyl-3H-indol-3-yl)-9H-pyrido[3,4-b]indole-3-carboxamide
N-(6-methoxy-2-oxo-1-phenyl-3H-indol-3-yl)-9H-pyrido[3,4-b]indole-3-carboxamide (PubChem CID 15284610) has the molecular formula C27H20N4O3
and a molecular weight of 448.48 g/mol. Its IUPAC name is N-(6-methoxy-2-oxo-1-phenyl-3H-indol-3-yl)-9H-pyrido[3,4-b]indole-3-carboxamide.
Molecular Properties
| Compound Name | N-(6-methoxy-2-oxo-1-phenyl-3H-indol-3-yl)-9H-pyrido[3,4-b]indole-3-carboxamide |
| PubChem CID | 15284610 |
| Molecular Formula | C27H20N4O3 |
| Molecular Weight | 448.48 g/mol |
| Exact Mass | 448.15 |
| IUPAC Name | N-(6-methoxy-2-oxo-1-phenyl-3H-indol-3-yl)-9H-pyrido[3,4-b]indole-3-carboxamide |
| SMILES | COc1ccc2c(c1)N(c1ccccc1)C(=O)C2NC(=O)c1cc2c(cn1)[nH]c1ccccc12 |
| InChI | InChI=1S/C27H20N4O3/c1-34-17-11-12-19-24(13-17)31(16-7-3-2-4-8-16)27(33)25(19)30-26(32)22-14-20-18-9-5-6-10-21(18)29-23(20)15-28-22/h2-15,25,29H,1H3,(H,30,32) |
| InChIKey | MACKKOJIENAJTO-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 87.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 448.48 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(6-methoxy-2-oxo-1-phenyl-3H-indol-3-yl)-9H-pyrido[3,4-b]indole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(6-methoxy-2-oxo-1-phenyl-3H-indol-3-yl)-9H-pyrido[3,4-b]indole-3-carboxamide?
The IUPAC name of N-(6-methoxy-2-oxo-1-phenyl-3H-indol-3-yl)-9H-pyrido[3,4-b]indole-3-carboxamide (CID 15284610) is N-(6-methoxy-2-oxo-1-phenyl-3H-indol-3-yl)-9H-pyrido[3,4-b]indole-3-carboxamide.
What is the SMILES notation for N-(6-methoxy-2-oxo-1-phenyl-3H-indol-3-yl)-9H-pyrido[3,4-b]indole-3-carboxamide?
The canonical SMILES for N-(6-methoxy-2-oxo-1-phenyl-3H-indol-3-yl)-9H-pyrido[3,4-b]indole-3-carboxamide is COc1ccc2c(c1)N(c1ccccc1)C(=O)C2NC(=O)c1cc2c(cn1)[nH]c1ccccc12.
What is the InChIKey of N-(6-methoxy-2-oxo-1-phenyl-3H-indol-3-yl)-9H-pyrido[3,4-b]indole-3-carboxamide?
The InChIKey is MACKKOJIENAJTO-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H20N4O3/c1-34-17-11-12-19-24(13-17)31(16-7-3-2-4-8-16)27(33)25(19)30-26(32)22-14-20-18-9-5-6-10-21(18)29-23(20)15-28-22/h2-15,25,29H,1H3,(H,30,32).
What are the key properties of N-(6-methoxy-2-oxo-1-phenyl-3H-indol-3-yl)-9H-pyrido[3,4-b]indole-3-carboxamide?
N-(6-methoxy-2-oxo-1-phenyl-3H-indol-3-yl)-9H-pyrido[3,4-b]indole-3-carboxamide has a molecular weight of 448.48 g/mol, XLogP of 4.87, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(6-methoxy-2-oxo-1-phenyl-3H-indol-3-yl)-9H-pyrido[3,4-b]indole-3-carboxamide is sourced from PubChem (CID 15284610), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).