C34H48IN4O3- — CID 152846379
CID 152846379 (PubChem CID 152846379) has the molecular formula C34H48IN4O3- and a molecular weight of 687.69 g/mol.
| Compound Name | CID 152846379 |
|---|---|
| PubChem CID | 152846379 |
| Molecular Formula | C34H48IN4O3- |
| Molecular Weight | 687.69 g/mol |
| Exact Mass | 687.28 |
| IUPAC Name | — |
| SMILES | CC(C)(C)OC(=O)N1CCC(CC(=O)N2CCN(C(c3ccc(C4C[I-]4)cc3)c3ccccn3)CC2C(C)(C)C)CC1 |
| InChI | InChI=1S/C34H48IN4O3/c1-33(2,3)29-23-38(31(28-9-7-8-16-36-28)26-12-10-25(11-13-26)27-22-35-27)19-20-39(29)30(40)21-24-14-17-37(18-15-24)32(41)42-34(4,5)6/h7-13,16,24,27,29,31H,14-15,17-23H2,1-6H3/q-1 |
| InChIKey | YGZLAWOIFNEJKX-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 65.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.69 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|